C9H15IN2 — CID 146532341
(1R,2S,6R,7S)-10-iodo-4-methyl-4,10-diazatricyclo[5.2.1.02,6]decane (PubChem CID 146532341) has the molecular formula C9H15IN2 and a molecular weight of 278.14 g/mol. Its IUPAC name is (1R,2S,6R,7S)-10-iodo-4-methyl-4,10-diazatricyclo[5.2.1.02,6]decane.
| Compound Name | (1R,2S,6R,7S)-10-iodo-4-methyl-4,10-diazatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 146532341 |
| Molecular Formula | C9H15IN2 |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | (1R,2S,6R,7S)-10-iodo-4-methyl-4,10-diazatricyclo[5.2.1.02,6]decane |
| SMILES | CN1C[C@@H]2[C@H](C1)[C@@H]1CC[C@H]2N1I |
| InChI | InChI=1S/C9H15IN2/c1-11-4-6-7(5-11)9-3-2-8(6)12(9)10/h6-9H,2-5H2,1H3/t6-,7+,8-,9+ |
| InChIKey | CBLHTHIPAYSAHH-SPJNRGJMSA-N |
| XLogP | 1.36 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|