C23H22ClN5OS — CID 146533196
7-(4-chlorocyclohexa-1,5-dien-1-yl)-9-[(4-methoxyphenyl)methyl]-5,13-dimethyl-3-thia-1,8,9,11,12-pentazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 146533196) has the molecular formula C23H22ClN5OS and a molecular weight of 451.98 g/mol. Its IUPAC name is 7-(4-chlorocyclohexa-1,5-dien-1-yl)-9-[(4-methoxyphenyl)methyl]-5,13-dimethyl-3-thia-1,8,9,11,12-pentazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | 7-(4-chlorocyclohexa-1,5-dien-1-yl)-9-[(4-methoxyphenyl)methyl]-5,13-dimethyl-3-thia-1,8,9,11,12-pentazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 146533196 |
| Molecular Formula | C23H22ClN5OS |
| Molecular Weight | 451.98 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 7-(4-chlorocyclohexa-1,5-dien-1-yl)-9-[(4-methoxyphenyl)methyl]-5,13-dimethyl-3-thia-1,8,9,11,12-pentazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | COc1ccc(CN2N=C(C3=CCC(Cl)C=C3)c3c(C)csc3-n3c(C)nnc32)cc1 |
| InChI | InChI=1S/C23H22ClN5OS/c1-14-13-31-22-20(14)21(17-6-8-18(24)9-7-17)27-28(23-26-25-15(2)29(22)23)12-16-4-10-19(30-3)11-5-16/h4-8,10-11,13,18H,9,12H2,1-3H3 |
| InChIKey | GIAYRFDUCJRLTI-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 55.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.98 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|