About (2Z)-2-ethylidene-N-(1-hydroxy-2-methylpropan-2-yl)-3,4-dimethylpent-3-enamide
(2Z)-2-ethylidene-N-(1-hydroxy-2-methylpropan-2-yl)-3,4-dimethylpent-3-enamide (PubChem CID 146534420) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is (2Z)-2-ethylidene-N-(1-hydroxy-2-methylpropan-2-yl)-3,4-dimethylpent-3-enamide.
Molecular Properties
| Compound Name | (2Z)-2-ethylidene-N-(1-hydroxy-2-methylpropan-2-yl)-3,4-dimethylpent-3-enamide |
| PubChem CID | 146534420 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (2Z)-2-ethylidene-N-(1-hydroxy-2-methylpropan-2-yl)-3,4-dimethylpent-3-enamide |
| SMILES | C/C=C(\C(=O)NC(C)(C)CO)C(C)=C(C)C |
| InChI | InChI=1S/C13H23NO2/c1-7-11(10(4)9(2)3)12(16)14-13(5,6)8-15/h7,15H,8H2,1-6H3,(H,14,16)/b11-7- |
| InChIKey | QAJXJHYRICPBSO-XFFZJAGNSA-N |
| XLogP | 2.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-ethylidene-N-(1-hydroxy-2-methylpropan-2-yl)-3,4-dimethylpent-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-ethylidene-N-(1-hydroxy-2-methylpropan-2-yl)-3,4-dimethylpent-3-enamide?
The IUPAC name of (2Z)-2-ethylidene-N-(1-hydroxy-2-methylpropan-2-yl)-3,4-dimethylpent-3-enamide (CID 146534420) is (2Z)-2-ethylidene-N-(1-hydroxy-2-methylpropan-2-yl)-3,4-dimethylpent-3-enamide.
What is the SMILES notation for (2Z)-2-ethylidene-N-(1-hydroxy-2-methylpropan-2-yl)-3,4-dimethylpent-3-enamide?
The canonical SMILES for (2Z)-2-ethylidene-N-(1-hydroxy-2-methylpropan-2-yl)-3,4-dimethylpent-3-enamide is C/C=C(\C(=O)NC(C)(C)CO)C(C)=C(C)C.
What is the InChIKey of (2Z)-2-ethylidene-N-(1-hydroxy-2-methylpropan-2-yl)-3,4-dimethylpent-3-enamide?
The InChIKey is QAJXJHYRICPBSO-XFFZJAGNSA-N. The full InChI is InChI=1S/C13H23NO2/c1-7-11(10(4)9(2)3)12(16)14-13(5,6)8-15/h7,15H,8H2,1-6H3,(H,14,16)/b11-7-.
What are the key properties of (2Z)-2-ethylidene-N-(1-hydroxy-2-methylpropan-2-yl)-3,4-dimethylpent-3-enamide?
(2Z)-2-ethylidene-N-(1-hydroxy-2-methylpropan-2-yl)-3,4-dimethylpent-3-enamide has a molecular weight of 225.33 g/mol, XLogP of 2.18, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-ethylidene-N-(1-hydroxy-2-methylpropan-2-yl)-3,4-dimethylpent-3-enamide is sourced from PubChem (CID 146534420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).