About S-(2-cyanoethyl) 4-methylbenzenecarbothioate
S-(2-cyanoethyl) 4-methylbenzenecarbothioate (PubChem CID 146534454) has the molecular formula C11H11NOS
and a molecular weight of 205.28 g/mol. Its IUPAC name is S-(2-cyanoethyl) 4-methylbenzenecarbothioate.
Molecular Properties
| Compound Name | S-(2-cyanoethyl) 4-methylbenzenecarbothioate |
| PubChem CID | 146534454 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | S-(2-cyanoethyl) 4-methylbenzenecarbothioate |
| SMILES | Cc1ccc(C(=O)SCCC#N)cc1 |
| InChI | InChI=1S/C11H11NOS/c1-9-3-5-10(6-4-9)11(13)14-8-2-7-12/h3-6H,2,8H2,1H3 |
| InChIKey | LVAOZJMCQMMKDM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-cyanoethyl) 4-methylbenzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-cyanoethyl) 4-methylbenzenecarbothioate?
The IUPAC name of S-(2-cyanoethyl) 4-methylbenzenecarbothioate (CID 146534454) is S-(2-cyanoethyl) 4-methylbenzenecarbothioate.
What is the SMILES notation for S-(2-cyanoethyl) 4-methylbenzenecarbothioate?
The canonical SMILES for S-(2-cyanoethyl) 4-methylbenzenecarbothioate is Cc1ccc(C(=O)SCCC#N)cc1.
What is the InChIKey of S-(2-cyanoethyl) 4-methylbenzenecarbothioate?
The InChIKey is LVAOZJMCQMMKDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NOS/c1-9-3-5-10(6-4-9)11(13)14-8-2-7-12/h3-6H,2,8H2,1H3.
What are the key properties of S-(2-cyanoethyl) 4-methylbenzenecarbothioate?
S-(2-cyanoethyl) 4-methylbenzenecarbothioate has a molecular weight of 205.28 g/mol, XLogP of 2.78, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-cyanoethyl) 4-methylbenzenecarbothioate is sourced from PubChem (CID 146534454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).