C24H31NO5 — CID 146534531
[4-(2,2-dimethylhex-5-ynoyloxymethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyl 2,2-dimethylhex-5-ynoate (PubChem CID 146534531) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is [4-(2,2-dimethylhex-5-ynoyloxymethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyl 2,2-dimethylhex-5-ynoate.
| Compound Name | [4-(2,2-dimethylhex-5-ynoyloxymethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyl 2,2-dimethylhex-5-ynoate |
|---|---|
| PubChem CID | 146534531 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | [4-(2,2-dimethylhex-5-ynoyloxymethyl)-5-hydroxy-6-methyl-3-pyridinyl]methyl 2,2-dimethylhex-5-ynoate |
| SMILES | C#CCCC(C)(C)C(=O)OCc1cnc(C)c(O)c1COC(=O)C(C)(C)CCC#C |
| InChI | InChI=1S/C24H31NO5/c1-8-10-12-23(4,5)21(27)29-15-18-14-25-17(3)20(26)19(18)16-30-22(28)24(6,7)13-11-9-2/h1-2,14,26H,10-13,15-16H2,3-7H3 |
| InChIKey | FITAOPYRGOAKIG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|