C72H50N8O8 — CID 146536031
3-[4-amino-3-[10,15,20-tris[2-amino-5-(3-carboxyphenyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]benzoic acid (PubChem CID 146536031) has the molecular formula C72H50N8O8 and a molecular weight of 1155.24 g/mol. Its IUPAC name is 3-[4-amino-3-[10,15,20-tris[2-amino-5-(3-carboxyphenyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]benzoic acid.
| Compound Name | 3-[4-amino-3-[10,15,20-tris[2-amino-5-(3-carboxyphenyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 146536031 |
| Molecular Formula | C72H50N8O8 |
| Molecular Weight | 1155.24 g/mol |
| Exact Mass | 1154.38 |
| IUPAC Name | 3-[4-amino-3-[10,15,20-tris[2-amino-5-(3-carboxyphenyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]benzoic acid |
| SMILES | Nc1ccc(-c2cccc(C(=O)O)c2)cc1-c1c2nc(c(-c3cc(-c4cccc(C(=O)O)c4)ccc3N)c3ccc([nH]3)c(-c3cc(-c4cccc(C(=O)O)c4)ccc3N)c3nc(c(-c4cc(-c5cccc(C(=O)O)c5)ccc4N)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C72H50N8O8/c73-53-17-13-41(37-5-1-9-45(29-37)69(81)82)33-49(53)65-57-21-23-59(77-57)66(50-34-42(14-18-54(50)74)38-6-2-10-46(30-38)70(83)84)61-25-27-63(79-61)68(52-36-44(16-20-56(52)76)40-8-4-12-48(32-40)72(87)88)64-28-26-62(80-64)67(60-24-22-58(65)78-60)51-35-43(15-19-55(51)75)39-7-3-11-47(31-39)71(85)86/h1-36,77,80H,73-76H2,(H,81,82)(H,83,84)(H,85,86)(H,87,88)/b65-57-,65-58-,66-59-,66-61-,67-60-,67-62-,68-63-,68-64- |
| InChIKey | PUTFECUSDBHUEW-ZOUHOBQGSA-N |
| XLogP | 15.11 |
| TPSA | 310.64 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 88 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1155.24 |
| LogP ≤ 5 | 15.11 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|