C15H25NS — CID 146536131
4-[methyl-[(3E,5Z)-8-methylnona-1,3,5,8-tetraen-2-yl]amino]butane-1-thiol (PubChem CID 146536131) has the molecular formula C15H25NS and a molecular weight of 251.44 g/mol. Its IUPAC name is 4-[methyl-[(3E,5Z)-8-methylnona-1,3,5,8-tetraen-2-yl]amino]butane-1-thiol.
| Compound Name | 4-[methyl-[(3E,5Z)-8-methylnona-1,3,5,8-tetraen-2-yl]amino]butane-1-thiol |
|---|---|
| PubChem CID | 146536131 |
| Molecular Formula | C15H25NS |
| Molecular Weight | 251.44 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 4-[methyl-[(3E,5Z)-8-methylnona-1,3,5,8-tetraen-2-yl]amino]butane-1-thiol |
| SMILES | C=C(C)C/C=C\C=C\C(=C)N(C)CCCCS |
| InChI | InChI=1S/C15H25NS/c1-14(2)10-6-5-7-11-15(3)16(4)12-8-9-13-17/h5-7,11,17H,1,3,8-10,12-13H2,2,4H3/b6-5-,11-7+ |
| InChIKey | SPLCINTVDLBKEI-GNLLZQBYSA-N |
| XLogP | 4.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|