C18H20N4O — CID 146536698
2-amino-N,N-dimethyl-5-spiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopropane]-5-ylbenzamide (PubChem CID 146536698) has the molecular formula C18H20N4O and a molecular weight of 308.39 g/mol. Its IUPAC name is 2-amino-N,N-dimethyl-5-spiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopropane]-5-ylbenzamide.
| Compound Name | 2-amino-N,N-dimethyl-5-spiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopropane]-5-ylbenzamide |
|---|---|
| PubChem CID | 146536698 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-amino-N,N-dimethyl-5-spiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,1'-cyclopropane]-5-ylbenzamide |
| SMILES | CN(C)C(=O)c1cc(-c2cnc3c(c2)C2(CC2)CN3)ccc1N |
| InChI | InChI=1S/C18H20N4O/c1-22(2)17(23)13-7-11(3-4-15(13)19)12-8-14-16(20-9-12)21-10-18(14)5-6-18/h3-4,7-9H,5-6,10,19H2,1-2H3,(H,20,21) |
| InChIKey | WPABMSKPBVBVGZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|