C22H23ClFN5O — CID 146536763
6-amino-3-[(1'S,3R)-4-chloro-1'-cyano-1'-methylspiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,3'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide (PubChem CID 146536763) has the molecular formula C22H23ClFN5O and a molecular weight of 427.91 g/mol. Its IUPAC name is 6-amino-3-[(1'S,3R)-4-chloro-1'-cyano-1'-methylspiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,3'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide.
| Compound Name | 6-amino-3-[(1'S,3R)-4-chloro-1'-cyano-1'-methylspiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,3'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 146536763 |
| Molecular Formula | C22H23ClFN5O |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 6-amino-3-[(1'S,3R)-4-chloro-1'-cyano-1'-methylspiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,3'-cyclopentane]-5-yl]-2-fluoro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1c(N)ccc(-c2cnc3c(c2Cl)[C@]2(CC[C@](C)(C#N)C2)CN3)c1F |
| InChI | InChI=1S/C22H23ClFN5O/c1-21(10-25)6-7-22(9-21)11-28-19-16(22)17(23)13(8-27-19)12-4-5-14(26)15(18(12)24)20(30)29(2)3/h4-5,8H,6-7,9,11,26H2,1-3H3,(H,27,28)/t21-,22-/m0/s1 |
| InChIKey | MEGZDIWLMMWZIF-VXKWHMMOSA-N |
| XLogP | 4.20 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|