C20H20ClN3O — CID 146537074
3-(4-chlorospiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,4'-cyclopentene]-5-yl)-N,N-dimethylbenzamide (PubChem CID 146537074) has the molecular formula C20H20ClN3O and a molecular weight of 353.85 g/mol. Its IUPAC name is 3-(4-chlorospiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,4'-cyclopentene]-5-yl)-N,N-dimethylbenzamide.
| Compound Name | 3-(4-chlorospiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,4'-cyclopentene]-5-yl)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 146537074 |
| Molecular Formula | C20H20ClN3O |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 3-(4-chlorospiro[1,2-dihydropyrrolo[2,3-b]pyridine-3,4'-cyclopentene]-5-yl)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(-c2cnc3c(c2Cl)C2(CC=CC2)CN3)c1 |
| InChI | InChI=1S/C20H20ClN3O/c1-24(2)19(25)14-7-5-6-13(10-14)15-11-22-18-16(17(15)21)20(12-23-18)8-3-4-9-20/h3-7,10-11H,8-9,12H2,1-2H3,(H,22,23) |
| InChIKey | WMCCYHOWUPTHJQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|