C13H21NO — CID 146537519
(6Z,8Z)-10-(dimethylamino)undeca-1,6,8,10-tetraen-2-ol (PubChem CID 146537519) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (6Z,8Z)-10-(dimethylamino)undeca-1,6,8,10-tetraen-2-ol.
| Compound Name | (6Z,8Z)-10-(dimethylamino)undeca-1,6,8,10-tetraen-2-ol |
|---|---|
| PubChem CID | 146537519 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (6Z,8Z)-10-(dimethylamino)undeca-1,6,8,10-tetraen-2-ol |
| SMILES | C=C(O)CCC/C=C\C=C/C(=C)N(C)C |
| InChI | InChI=1S/C13H21NO/c1-12(14(3)4)10-8-6-5-7-9-11-13(2)15/h5-6,8,10,15H,1-2,7,9,11H2,3-4H3/b6-5-,10-8- |
| InChIKey | LALBNRBQGVZJKT-XUTLIFGGSA-N |
| XLogP | 3.42 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|