About (1Z,3Z)-1-hydroperoxy-2-methylpenta-1,3-diene
(1Z,3Z)-1-hydroperoxy-2-methylpenta-1,3-diene (PubChem CID 146537584) has the molecular formula C6H10O2
and a molecular weight of 114.14 g/mol. Its IUPAC name is (1Z,3Z)-1-hydroperoxy-2-methylpenta-1,3-diene.
Molecular Properties
| Compound Name | (1Z,3Z)-1-hydroperoxy-2-methylpenta-1,3-diene |
| PubChem CID | 146537584 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | (1Z,3Z)-1-hydroperoxy-2-methylpenta-1,3-diene |
| SMILES | C/C=C\C(C)=C/OO |
| InChI | InChI=1S/C6H10O2/c1-3-4-6(2)5-8-7/h3-5,7H,1-2H3/b4-3-,6-5- |
| InChIKey | PRGHFUHDAQXNTE-OUPQRBNQSA-N |
| XLogP | 1.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z,3Z)-1-hydroperoxy-2-methylpenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,3Z)-1-hydroperoxy-2-methylpenta-1,3-diene?
The IUPAC name of (1Z,3Z)-1-hydroperoxy-2-methylpenta-1,3-diene (CID 146537584) is (1Z,3Z)-1-hydroperoxy-2-methylpenta-1,3-diene.
What is the SMILES notation for (1Z,3Z)-1-hydroperoxy-2-methylpenta-1,3-diene?
The canonical SMILES for (1Z,3Z)-1-hydroperoxy-2-methylpenta-1,3-diene is C/C=C\C(C)=C/OO.
What is the InChIKey of (1Z,3Z)-1-hydroperoxy-2-methylpenta-1,3-diene?
The InChIKey is PRGHFUHDAQXNTE-OUPQRBNQSA-N. The full InChI is InChI=1S/C6H10O2/c1-3-4-6(2)5-8-7/h3-5,7H,1-2H3/b4-3-,6-5-.
What are the key properties of (1Z,3Z)-1-hydroperoxy-2-methylpenta-1,3-diene?
(1Z,3Z)-1-hydroperoxy-2-methylpenta-1,3-diene has a molecular weight of 114.14 g/mol, XLogP of 1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,3Z)-1-hydroperoxy-2-methylpenta-1,3-diene is sourced from PubChem (CID 146537584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).