C13H21F2N — CID 146537629
(3Z,5E)-10,10-difluoro-6,8-dimethylundeca-1,3,5-trien-3-amine (PubChem CID 146537629) has the molecular formula C13H21F2N and a molecular weight of 229.31 g/mol. Its IUPAC name is (3Z,5E)-10,10-difluoro-6,8-dimethylundeca-1,3,5-trien-3-amine.
| Compound Name | (3Z,5E)-10,10-difluoro-6,8-dimethylundeca-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 146537629 |
| Molecular Formula | C13H21F2N |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | (3Z,5E)-10,10-difluoro-6,8-dimethylundeca-1,3,5-trien-3-amine |
| SMILES | C=C/C(N)=C/C=C(\C)CC(C)CC(C)(F)F |
| InChI | InChI=1S/C13H21F2N/c1-5-12(16)7-6-10(2)8-11(3)9-13(4,14)15/h5-7,11H,1,8-9,16H2,2-4H3/b10-6+,12-7- |
| InChIKey | XRZBKQCHOQOMNC-NGSBCVAZSA-N |
| XLogP | 4.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|