C24H23F3N6OS — CID 146537634
6-[(1S)-1-amino-5,6,7-trifluorospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-5-methyl-3-(5-methylthiophen-2-yl)-2H-pyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 146537634) has the molecular formula C24H23F3N6OS and a molecular weight of 500.55 g/mol. Its IUPAC name is 6-[(1S)-1-amino-5,6,7-trifluorospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-5-methyl-3-(5-methylthiophen-2-yl)-2H-pyrazolo[3,4-d]pyrimidin-4-one.
| Compound Name | 6-[(1S)-1-amino-5,6,7-trifluorospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-5-methyl-3-(5-methylthiophen-2-yl)-2H-pyrazolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 146537634 |
| Molecular Formula | C24H23F3N6OS |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 6-[(1S)-1-amino-5,6,7-trifluorospiro[1,3-dihydroindene-2,4'-piperidine]-1'-yl]-5-methyl-3-(5-methylthiophen-2-yl)-2H-pyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | Cc1ccc(-c2[nH]nc3nc(N4CCC5(CC4)Cc4cc(F)c(F)c(F)c4[C@H]5N)n(C)c(=O)c23)s1 |
| InChI | InChI=1S/C24H23F3N6OS/c1-11-3-4-14(35-11)19-16-21(31-30-19)29-23(32(2)22(16)34)33-7-5-24(6-8-33)10-12-9-13(25)17(26)18(27)15(12)20(24)28/h3-4,9,20H,5-8,10,28H2,1-2H3,(H,30,31)/t20-/m1/s1 |
| InChIKey | NNHBLNWDTCZMKR-HXUWFJFHSA-N |
| XLogP | 3.95 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|