C9H17F3N2O — CID 146537669
(E)-4-methyl-1-(2,2,2-trifluoroethoxy)hex-3-ene-1,5-diamine (PubChem CID 146537669) has the molecular formula C9H17F3N2O and a molecular weight of 226.24 g/mol. Its IUPAC name is (E)-4-methyl-1-(2,2,2-trifluoroethoxy)hex-3-ene-1,5-diamine.
| Compound Name | (E)-4-methyl-1-(2,2,2-trifluoroethoxy)hex-3-ene-1,5-diamine |
|---|---|
| PubChem CID | 146537669 |
| Molecular Formula | C9H17F3N2O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | (E)-4-methyl-1-(2,2,2-trifluoroethoxy)hex-3-ene-1,5-diamine |
| SMILES | C/C(=C\CC(N)OCC(F)(F)F)C(C)N |
| InChI | InChI=1S/C9H17F3N2O/c1-6(7(2)13)3-4-8(14)15-5-9(10,11)12/h3,7-8H,4-5,13-14H2,1-2H3/b6-3+ |
| InChIKey | RWPXADPIWAQZMI-ZZXKWVIFSA-N |
| XLogP | 1.53 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|