C30H27N3S — CID 146538441
6-[2-[6-(1,2-dihydrophenothiazin-10-yl)cyclohex-2-en-1-yl]phenyl]-3,4-dihydropyridine-5-carbonitrile (PubChem CID 146538441) has the molecular formula C30H27N3S and a molecular weight of 461.63 g/mol. Its IUPAC name is 6-[2-[6-(1,2-dihydrophenothiazin-10-yl)cyclohex-2-en-1-yl]phenyl]-3,4-dihydropyridine-5-carbonitrile.
| Compound Name | 6-[2-[6-(1,2-dihydrophenothiazin-10-yl)cyclohex-2-en-1-yl]phenyl]-3,4-dihydropyridine-5-carbonitrile |
|---|---|
| PubChem CID | 146538441 |
| Molecular Formula | C30H27N3S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 6-[2-[6-(1,2-dihydrophenothiazin-10-yl)cyclohex-2-en-1-yl]phenyl]-3,4-dihydropyridine-5-carbonitrile |
| SMILES | N#CC1=C(c2ccccc2C2C=CCCC2N2C3=C(C=CCC3)Sc3ccccc32)N=CCC1 |
| InChI | InChI=1S/C30H27N3S/c31-20-21-10-9-19-32-30(21)24-13-2-1-11-22(24)23-12-3-4-14-25(23)33-26-15-5-7-17-28(26)34-29-18-8-6-16-27(29)33/h1-3,5,7-8,11-13,15,17-19,23,25H,4,6,9-10,14,16H2 |
| InChIKey | PPKJPDYXORLITF-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|