C36H40N4 — CID 146538536
2-[5-[3-(10-cyclohexa-2,4-dien-1-yl-3,4,5a,9a-tetrahydrophenazin-5-yl)cyclohexen-1-yl]cyclohexen-1-yl]-2,3-dihydropyridine-6-carbonitrile (PubChem CID 146538536) has the molecular formula C36H40N4 and a molecular weight of 528.74 g/mol. Its IUPAC name is 2-[5-[3-(10-cyclohexa-2,4-dien-1-yl-3,4,5a,9a-tetrahydrophenazin-5-yl)cyclohexen-1-yl]cyclohexen-1-yl]-2,3-dihydropyridine-6-carbonitrile.
| Compound Name | 2-[5-[3-(10-cyclohexa-2,4-dien-1-yl-3,4,5a,9a-tetrahydrophenazin-5-yl)cyclohexen-1-yl]cyclohexen-1-yl]-2,3-dihydropyridine-6-carbonitrile |
|---|---|
| PubChem CID | 146538536 |
| Molecular Formula | C36H40N4 |
| Molecular Weight | 528.74 g/mol |
| Exact Mass | 528.33 |
| IUPAC Name | 2-[5-[3-(10-cyclohexa-2,4-dien-1-yl-3,4,5a,9a-tetrahydrophenazin-5-yl)cyclohexen-1-yl]cyclohexen-1-yl]-2,3-dihydropyridine-6-carbonitrile |
| SMILES | N#CC1=NC(C2=CCCC(C3=CC(N4C5=C(C=CCC5)N(C5C=CC=CC5)C5C=CC=CC54)CCC3)C2)CC=C1 |
| InChI | InChI=1S/C36H40N4/c37-25-29-14-10-18-32(38-29)28-13-8-11-26(23-28)27-12-9-17-31(24-27)40-35-21-6-4-19-33(35)39(30-15-2-1-3-16-30)34-20-5-7-22-36(34)40/h1-6,10,13-15,19-21,24,26,30-33,35H,7-9,11-12,16-18,22-23H2 |
| InChIKey | SUFFLWYNGCIHHR-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 42.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.74 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|