C17H18F2N2O4S — CID 146539206
S-[(1R,2S)-2-[[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]amino]cyclopentyl] ethanethioate (PubChem CID 146539206) has the molecular formula C17H18F2N2O4S and a molecular weight of 384.40 g/mol. Its IUPAC name is S-[(1R,2S)-2-[[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]amino]cyclopentyl] ethanethioate.
| Compound Name | S-[(1R,2S)-2-[[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]amino]cyclopentyl] ethanethioate |
|---|---|
| PubChem CID | 146539206 |
| Molecular Formula | C17H18F2N2O4S |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | S-[(1R,2S)-2-[[5-(1,3-dioxolan-2-yl)-6,7-difluoro-1,2-benzoxazol-3-yl]amino]cyclopentyl] ethanethioate |
| SMILES | CC(=O)S[C@@H]1CCC[C@@H]1Nc1noc2c(F)c(F)c(C3OCCO3)cc12 |
| InChI | InChI=1S/C17H18F2N2O4S/c1-8(22)26-12-4-2-3-11(12)20-16-10-7-9(17-23-5-6-24-17)13(18)14(19)15(10)25-21-16/h7,11-12,17H,2-6H2,1H3,(H,20,21)/t11-,12+/m0/s1 |
| InChIKey | LMJHTPFOXDZYJP-NWDGAFQWSA-N |
| XLogP | 3.76 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|