C10H13N3 — CID 146539347
4-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1,2,4-triazole (PubChem CID 146539347) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 4-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1,2,4-triazole.
| Compound Name | 4-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 146539347 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 4-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1,2,4-triazole |
| SMILES | C=C/C(=C\C=C(C)C)n1cnnc1 |
| InChI | InChI=1S/C10H13N3/c1-4-10(6-5-9(2)3)13-7-11-12-8-13/h4-8H,1H2,2-3H3/b10-6+ |
| InChIKey | QTAFGPSDTGZGTQ-UXBLZVDNSA-N |
| XLogP | 2.27 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|