C11H13N3 — CID 146539349
4-[(3E,5Z)-6-methylocta-1,3,5,7-tetraen-3-yl]-1,2,4-triazole (PubChem CID 146539349) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 4-[(3E,5Z)-6-methylocta-1,3,5,7-tetraen-3-yl]-1,2,4-triazole.
| Compound Name | 4-[(3E,5Z)-6-methylocta-1,3,5,7-tetraen-3-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 146539349 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 4-[(3E,5Z)-6-methylocta-1,3,5,7-tetraen-3-yl]-1,2,4-triazole |
| SMILES | C=C/C(C)=C\C=C(/C=C)n1cnnc1 |
| InChI | InChI=1S/C11H13N3/c1-4-10(3)6-7-11(5-2)14-8-12-13-9-14/h4-9H,1-2H2,3H3/b10-6-,11-7+ |
| InChIKey | FMJCVJUGCSVUDB-NAKBGQTNSA-N |
| XLogP | 2.44 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|