C39H46N4 — CID 146539397
6-[6-methyl-6-[6-methyl-5-[10-(3-methylcyclohexen-1-yl)-3,4,5a,9a-tetrahydrophenazin-5-yl]cyclohexa-1,3-dien-1-yl]cyclohex-3-en-1-yl]-3,4-dihydropyridine-2-carbonitrile (PubChem CID 146539397) has the molecular formula C39H46N4 and a molecular weight of 570.83 g/mol. Its IUPAC name is 6-[6-methyl-6-[6-methyl-5-[10-(3-methylcyclohexen-1-yl)-3,4,5a,9a-tetrahydrophenazin-5-yl]cyclohexa-1,3-dien-1-yl]cyclohex-3-en-1-yl]-3,4-dihydropyridine-2-carbonitrile.
| Compound Name | 6-[6-methyl-6-[6-methyl-5-[10-(3-methylcyclohexen-1-yl)-3,4,5a,9a-tetrahydrophenazin-5-yl]cyclohexa-1,3-dien-1-yl]cyclohex-3-en-1-yl]-3,4-dihydropyridine-2-carbonitrile |
|---|---|
| PubChem CID | 146539397 |
| Molecular Formula | C39H46N4 |
| Molecular Weight | 570.83 g/mol |
| Exact Mass | 570.37 |
| IUPAC Name | 6-[6-methyl-6-[6-methyl-5-[10-(3-methylcyclohexen-1-yl)-3,4,5a,9a-tetrahydrophenazin-5-yl]cyclohexa-1,3-dien-1-yl]cyclohex-3-en-1-yl]-3,4-dihydropyridine-2-carbonitrile |
| SMILES | CC1C=C(N2C3=C(CCC=C3)N(C3C=CC=C(C4(C)CC=CCC4C4=CCCC(C#N)=N4)C3C)C3C=CC=CC32)CCC1 |
| InChI | InChI=1S/C39H46N4/c1-27-13-10-15-30(25-27)42-35-19-4-6-21-37(35)43(38-22-7-5-20-36(38)42)34-23-12-17-31(28(34)2)39(3)24-9-8-16-32(39)33-18-11-14-29(26-40)41-33/h4-6,8-9,12,17-21,23,25,27-28,32,34-35,37H,7,10-11,13-16,22,24H2,1-3H3 |
| InChIKey | JLYWAIXKNONHMO-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 42.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.83 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|