About (E)-N-ethyl-N,2-dimethylbut-2-en-1-amine;(E)-N-ethyl-2-methylbut-2-en-1-amine
(E)-N-ethyl-N,2-dimethylbut-2-en-1-amine;(E)-N-ethyl-2-methylbut-2-en-1-amine (PubChem CID 146540551) has the molecular formula C15H32N2
and a molecular weight of 240.43 g/mol. Its IUPAC name is (E)-N-ethyl-N,2-dimethylbut-2-en-1-amine;(E)-N-ethyl-2-methylbut-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-N-ethyl-N,2-dimethylbut-2-en-1-amine;(E)-N-ethyl-2-methylbut-2-en-1-amine |
| PubChem CID | 146540551 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | (E)-N-ethyl-N,2-dimethylbut-2-en-1-amine;(E)-N-ethyl-2-methylbut-2-en-1-amine |
| SMILES | C/C=C(\C)CN(C)CC.C/C=C(\C)CNCC |
| InChI | InChI=1S/C8H17N.C7H15N/c1-5-8(3)7-9(4)6-2;1-4-7(3)6-8-5-2/h5H,6-7H2,1-4H3;4,8H,5-6H2,1-3H3/b8-5+;7-4+ |
| InChIKey | ZBNNYMCDNXQNSL-IDJYZFDHSA-N |
| XLogP | 3.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-ethyl-N,2-dimethylbut-2-en-1-amine;(E)-N-ethyl-2-methylbut-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-ethyl-N,2-dimethylbut-2-en-1-amine;(E)-N-ethyl-2-methylbut-2-en-1-amine?
The IUPAC name of (E)-N-ethyl-N,2-dimethylbut-2-en-1-amine;(E)-N-ethyl-2-methylbut-2-en-1-amine (CID 146540551) is (E)-N-ethyl-N,2-dimethylbut-2-en-1-amine;(E)-N-ethyl-2-methylbut-2-en-1-amine.
What is the SMILES notation for (E)-N-ethyl-N,2-dimethylbut-2-en-1-amine;(E)-N-ethyl-2-methylbut-2-en-1-amine?
The canonical SMILES for (E)-N-ethyl-N,2-dimethylbut-2-en-1-amine;(E)-N-ethyl-2-methylbut-2-en-1-amine is C/C=C(\C)CN(C)CC.C/C=C(\C)CNCC.
What is the InChIKey of (E)-N-ethyl-N,2-dimethylbut-2-en-1-amine;(E)-N-ethyl-2-methylbut-2-en-1-amine?
The InChIKey is ZBNNYMCDNXQNSL-IDJYZFDHSA-N. The full InChI is InChI=1S/C8H17N.C7H15N/c1-5-8(3)7-9(4)6-2;1-4-7(3)6-8-5-2/h5H,6-7H2,1-4H3;4,8H,5-6H2,1-3H3/b8-5+;7-4+.
What are the key properties of (E)-N-ethyl-N,2-dimethylbut-2-en-1-amine;(E)-N-ethyl-2-methylbut-2-en-1-amine?
(E)-N-ethyl-N,2-dimethylbut-2-en-1-amine;(E)-N-ethyl-2-methylbut-2-en-1-amine has a molecular weight of 240.43 g/mol, XLogP of 3.47, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-ethyl-N,2-dimethylbut-2-en-1-amine;(E)-N-ethyl-2-methylbut-2-en-1-amine is sourced from PubChem (CID 146540551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).