C13H11F3O7S — CID 14654082
[(4aR,7S,7aS)-6-oxo-2-phenyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-7-yl] trifluoromethanesulfonate (PubChem CID 14654082) has the molecular formula C13H11F3O7S and a molecular weight of 368.29 g/mol. Its IUPAC name is [(4aR,7S,7aS)-6-oxo-2-phenyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-7-yl] trifluoromethanesulfonate.
| Compound Name | [(4aR,7S,7aS)-6-oxo-2-phenyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 14654082 |
| Molecular Formula | C13H11F3O7S |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | [(4aR,7S,7aS)-6-oxo-2-phenyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-7-yl] trifluoromethanesulfonate |
| SMILES | O=C1O[C@@H]2COC(c3ccccc3)O[C@@H]2[C@@H]1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H11F3O7S/c14-13(15,16)24(18,19)23-10-9-8(21-11(10)17)6-20-12(22-9)7-4-2-1-3-5-7/h1-5,8-10,12H,6H2/t8-,9+,10+,12?/m1/s1 |
| InChIKey | GRXYGPCXNHKDSX-TUMWXBPRSA-N |
| XLogP | 1.26 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|