C8H3F12NO — CID 146541686
2,2,3,3,4,4,5,5-octafluoro-1-[(E)-1,3,3,3-tetrafluoro-2-methoxyprop-1-enyl]pyrrolidine (PubChem CID 146541686) has the molecular formula C8H3F12NO and a molecular weight of 357.09 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-1-[(E)-1,3,3,3-tetrafluoro-2-methoxyprop-1-enyl]pyrrolidine.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-1-[(E)-1,3,3,3-tetrafluoro-2-methoxyprop-1-enyl]pyrrolidine |
|---|---|
| PubChem CID | 146541686 |
| Molecular Formula | C8H3F12NO |
| Molecular Weight | 357.09 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-1-[(E)-1,3,3,3-tetrafluoro-2-methoxyprop-1-enyl]pyrrolidine |
| SMILES | CO/C(=C(/F)N1C(F)(F)C(F)(F)C(F)(F)C1(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H3F12NO/c1-22-2(4(10,11)12)3(9)21-7(17,18)5(13,14)6(15,16)8(21,19)20/h1H3/b3-2- |
| InChIKey | QOGLIOPMHMKFDN-IHWYPQMZSA-N |
| XLogP | 4.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.09 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|