About (2Z,4Z)-5-(trifluoromethyl)hepta-2,4-diene-4-thiol
(2Z,4Z)-5-(trifluoromethyl)hepta-2,4-diene-4-thiol (PubChem CID 146542239) has the molecular formula C8H11F3S
and a molecular weight of 196.24 g/mol. Its IUPAC name is (2Z,4Z)-5-(trifluoromethyl)hepta-2,4-diene-4-thiol.
Molecular Properties
| Compound Name | (2Z,4Z)-5-(trifluoromethyl)hepta-2,4-diene-4-thiol |
| PubChem CID | 146542239 |
| Molecular Formula | C8H11F3S |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | (2Z,4Z)-5-(trifluoromethyl)hepta-2,4-diene-4-thiol |
| SMILES | C/C=C\C(S)=C(/CC)C(F)(F)F |
| InChI | InChI=1S/C8H11F3S/c1-3-5-7(12)6(4-2)8(9,10)11/h3,5,12H,4H2,1-2H3/b5-3-,7-6- |
| InChIKey | WINGMNPAKZXDLX-VKLRWAGZSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-5-(trifluoromethyl)hepta-2,4-diene-4-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-5-(trifluoromethyl)hepta-2,4-diene-4-thiol?
The IUPAC name of (2Z,4Z)-5-(trifluoromethyl)hepta-2,4-diene-4-thiol (CID 146542239) is (2Z,4Z)-5-(trifluoromethyl)hepta-2,4-diene-4-thiol.
What is the SMILES notation for (2Z,4Z)-5-(trifluoromethyl)hepta-2,4-diene-4-thiol?
The canonical SMILES for (2Z,4Z)-5-(trifluoromethyl)hepta-2,4-diene-4-thiol is C/C=C\C(S)=C(/CC)C(F)(F)F.
What is the InChIKey of (2Z,4Z)-5-(trifluoromethyl)hepta-2,4-diene-4-thiol?
The InChIKey is WINGMNPAKZXDLX-VKLRWAGZSA-N. The full InChI is InChI=1S/C8H11F3S/c1-3-5-7(12)6(4-2)8(9,10)11/h3,5,12H,4H2,1-2H3/b5-3-,7-6-.
What are the key properties of (2Z,4Z)-5-(trifluoromethyl)hepta-2,4-diene-4-thiol?
(2Z,4Z)-5-(trifluoromethyl)hepta-2,4-diene-4-thiol has a molecular weight of 196.24 g/mol, XLogP of 3.72, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-5-(trifluoromethyl)hepta-2,4-diene-4-thiol is sourced from PubChem (CID 146542239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).