C15H23NO2 — CID 146542247
tert-butyl 4-methylidene-8-azaspiro[4.5]dec-2-ene-8-carboxylate (PubChem CID 146542247) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is tert-butyl 4-methylidene-8-azaspiro[4.5]dec-2-ene-8-carboxylate.
| Compound Name | tert-butyl 4-methylidene-8-azaspiro[4.5]dec-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 146542247 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | tert-butyl 4-methylidene-8-azaspiro[4.5]dec-2-ene-8-carboxylate |
| SMILES | C=C1C=CCC12CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C15H23NO2/c1-12-6-5-7-15(12)8-10-16(11-9-15)13(17)18-14(2,3)4/h5-6H,1,7-11H2,2-4H3 |
| InChIKey | QWOFLBQIAJESLT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |