C16H18N2O2 — CID 146542545
1,4-bis(methylamino)-1,2,8,8a-tetrahydroanthracene-9,10-dione (PubChem CID 146542545) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 1,4-bis(methylamino)-1,2,8,8a-tetrahydroanthracene-9,10-dione.
| Compound Name | 1,4-bis(methylamino)-1,2,8,8a-tetrahydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 146542545 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 1,4-bis(methylamino)-1,2,8,8a-tetrahydroanthracene-9,10-dione |
| SMILES | CNC1=CCC(NC)C2=C1C(=O)C1=CC=CCC1C2=O |
| InChI | InChI=1S/C16H18N2O2/c1-17-11-7-8-12(18-2)14-13(11)15(19)9-5-3-4-6-10(9)16(14)20/h3-5,7,10,12,17-18H,6,8H2,1-2H3 |
| InChIKey | UPWADSLATAFUDJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |