C31H21N3O — CID 146542844
3-[3-[2-[(1Z)-buta-1,3-dienyl]-3-methylfuro[2,3-a]carbazol-10-yl]phenyl]pyridine-4-carbonitrile (PubChem CID 146542844) has the molecular formula C31H21N3O and a molecular weight of 451.53 g/mol. Its IUPAC name is 3-[3-[2-[(1Z)-buta-1,3-dienyl]-3-methylfuro[2,3-a]carbazol-10-yl]phenyl]pyridine-4-carbonitrile.
| Compound Name | 3-[3-[2-[(1Z)-buta-1,3-dienyl]-3-methylfuro[2,3-a]carbazol-10-yl]phenyl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 146542844 |
| Molecular Formula | C31H21N3O |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 3-[3-[2-[(1Z)-buta-1,3-dienyl]-3-methylfuro[2,3-a]carbazol-10-yl]phenyl]pyridine-4-carbonitrile |
| SMILES | C=C/C=C\c1oc2c(ccc3c4ccccc4n(-c4cccc(-c5cnccc5C#N)c4)c32)c1C |
| InChI | InChI=1S/C31H21N3O/c1-3-4-12-29-20(2)24-13-14-26-25-10-5-6-11-28(25)34(30(26)31(24)35-29)23-9-7-8-21(17-23)27-19-33-16-15-22(27)18-32/h3-17,19H,1H2,2H3/b12-4- |
| InChIKey | LKEXVBVTOHYRQW-QCDXTXTGSA-N |
| XLogP | 7.97 |
| TPSA | 54.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|