C25H21FIN3O4 — CID 146543412
N-[3-[4-(2-fluoro-4-iodoanilino)-3,6,7-trimethyl-2,5-dioxopyrano[3,2-c]pyridin-8-yl]phenyl]acetamide (PubChem CID 146543412) has the molecular formula C25H21FIN3O4 and a molecular weight of 573.36 g/mol. Its IUPAC name is N-[3-[4-(2-fluoro-4-iodoanilino)-3,6,7-trimethyl-2,5-dioxopyrano[3,2-c]pyridin-8-yl]phenyl]acetamide.
| Compound Name | N-[3-[4-(2-fluoro-4-iodoanilino)-3,6,7-trimethyl-2,5-dioxopyrano[3,2-c]pyridin-8-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 146543412 |
| Molecular Formula | C25H21FIN3O4 |
| Molecular Weight | 573.36 g/mol |
| Exact Mass | 573.06 |
| IUPAC Name | N-[3-[4-(2-fluoro-4-iodoanilino)-3,6,7-trimethyl-2,5-dioxopyrano[3,2-c]pyridin-8-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-c2c(C)n(C)c(=O)c3c(Nc4ccc(I)cc4F)c(C)c(=O)oc23)c1 |
| InChI | InChI=1S/C25H21FIN3O4/c1-12-22(29-19-9-8-16(27)11-18(19)26)21-23(34-25(12)33)20(13(2)30(4)24(21)32)15-6-5-7-17(10-15)28-14(3)31/h5-11,29H,1-4H3,(H,28,31) |
| InChIKey | LDQUWZBKUUHKAT-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 93.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.36 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|