C25H21FIN3O3 — CID 146543436
8-(3-aminophenyl)-6-cyclopropyl-4-(2-fluoro-4-iodoanilino)-3,7-dimethylpyrano[3,2-c]pyridine-2,5-dione (PubChem CID 146543436) has the molecular formula C25H21FIN3O3 and a molecular weight of 557.36 g/mol. Its IUPAC name is 8-(3-aminophenyl)-6-cyclopropyl-4-(2-fluoro-4-iodoanilino)-3,7-dimethylpyrano[3,2-c]pyridine-2,5-dione.
| Compound Name | 8-(3-aminophenyl)-6-cyclopropyl-4-(2-fluoro-4-iodoanilino)-3,7-dimethylpyrano[3,2-c]pyridine-2,5-dione |
|---|---|
| PubChem CID | 146543436 |
| Molecular Formula | C25H21FIN3O3 |
| Molecular Weight | 557.36 g/mol |
| Exact Mass | 557.06 |
| IUPAC Name | 8-(3-aminophenyl)-6-cyclopropyl-4-(2-fluoro-4-iodoanilino)-3,7-dimethylpyrano[3,2-c]pyridine-2,5-dione |
| SMILES | Cc1c(Nc2ccc(I)cc2F)c2c(=O)n(C3CC3)c(C)c(-c3cccc(N)c3)c2oc1=O |
| InChI | InChI=1S/C25H21FIN3O3/c1-12-22(29-19-9-6-15(27)11-18(19)26)21-23(33-25(12)32)20(14-4-3-5-16(28)10-14)13(2)30(24(21)31)17-7-8-17/h3-6,9-11,17,29H,7-8,28H2,1-2H3 |
| InChIKey | MHSOCPYGAFSCAJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 90.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.36 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|