C26H24FN3O3 — CID 146543437
8-(3-aminophenyl)-6-cyclopropyl-4-(2-fluoro-4-methylanilino)-3,7-dimethylpyrano[3,2-c]pyridine-2,5-dione (PubChem CID 146543437) has the molecular formula C26H24FN3O3 and a molecular weight of 445.49 g/mol. Its IUPAC name is 8-(3-aminophenyl)-6-cyclopropyl-4-(2-fluoro-4-methylanilino)-3,7-dimethylpyrano[3,2-c]pyridine-2,5-dione.
| Compound Name | 8-(3-aminophenyl)-6-cyclopropyl-4-(2-fluoro-4-methylanilino)-3,7-dimethylpyrano[3,2-c]pyridine-2,5-dione |
|---|---|
| PubChem CID | 146543437 |
| Molecular Formula | C26H24FN3O3 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 8-(3-aminophenyl)-6-cyclopropyl-4-(2-fluoro-4-methylanilino)-3,7-dimethylpyrano[3,2-c]pyridine-2,5-dione |
| SMILES | Cc1ccc(Nc2c(C)c(=O)oc3c(-c4cccc(N)c4)c(C)n(C4CC4)c(=O)c23)c(F)c1 |
| InChI | InChI=1S/C26H24FN3O3/c1-13-7-10-20(19(27)11-13)29-23-14(2)26(32)33-24-21(16-5-4-6-17(28)12-16)15(3)30(18-8-9-18)25(31)22(23)24/h4-7,10-12,18,29H,8-9,28H2,1-3H3 |
| InChIKey | CBJNKLKNNJAFIR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 90.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|