C26H22FIN4O4 — CID 146543557
[3-[6-cyclopropyl-4-(2-fluoro-4-iodoanilino)-3,7-dimethyl-2,5-dioxopyrano[3,2-c]pyridin-8-yl]phenyl]urea (PubChem CID 146543557) has the molecular formula C26H22FIN4O4 and a molecular weight of 600.39 g/mol. Its IUPAC name is [3-[6-cyclopropyl-4-(2-fluoro-4-iodoanilino)-3,7-dimethyl-2,5-dioxopyrano[3,2-c]pyridin-8-yl]phenyl]urea.
| Compound Name | [3-[6-cyclopropyl-4-(2-fluoro-4-iodoanilino)-3,7-dimethyl-2,5-dioxopyrano[3,2-c]pyridin-8-yl]phenyl]urea |
|---|---|
| PubChem CID | 146543557 |
| Molecular Formula | C26H22FIN4O4 |
| Molecular Weight | 600.39 g/mol |
| Exact Mass | 600.07 |
| IUPAC Name | [3-[6-cyclopropyl-4-(2-fluoro-4-iodoanilino)-3,7-dimethyl-2,5-dioxopyrano[3,2-c]pyridin-8-yl]phenyl]urea |
| SMILES | Cc1c(Nc2ccc(I)cc2F)c2c(=O)n(C3CC3)c(C)c(-c3cccc(NC(N)=O)c3)c2oc1=O |
| InChI | InChI=1S/C26H22FIN4O4/c1-12-22(31-19-9-6-15(28)11-18(19)27)21-23(36-25(12)34)20(13(2)32(24(21)33)17-7-8-17)14-4-3-5-16(10-14)30-26(29)35/h3-6,9-11,17,31H,7-8H2,1-2H3,(H3,29,30,35) |
| InChIKey | LGYOEHMUCZMPHY-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.39 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|