About (2S,4R)-azetidine-2,4-dicarboxamide
(2S,4R)-azetidine-2,4-dicarboxamide (PubChem CID 14654422) has the molecular formula C5H9N3O2
and a molecular weight of 143.15 g/mol. Its IUPAC name is (2S,4R)-azetidine-2,4-dicarboxamide.
Molecular Properties
| Compound Name | (2S,4R)-azetidine-2,4-dicarboxamide |
| PubChem CID | 14654422 |
| Molecular Formula | C5H9N3O2 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | (2S,4R)-azetidine-2,4-dicarboxamide |
| SMILES | NC(=O)[C@@H]1C[C@H](C(N)=O)N1 |
| InChI | InChI=1S/C5H9N3O2/c6-4(9)2-1-3(8-2)5(7)10/h2-3,8H,1H2,(H2,6,9)(H2,7,10)/t2-,3+ |
| InChIKey | UNEMLOZFCVXAKB-WSOKHJQSSA-N |
| XLogP | -2.31 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,4R)-azetidine-2,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R)-azetidine-2,4-dicarboxamide?
The IUPAC name of (2S,4R)-azetidine-2,4-dicarboxamide (CID 14654422) is (2S,4R)-azetidine-2,4-dicarboxamide.
What is the SMILES notation for (2S,4R)-azetidine-2,4-dicarboxamide?
The canonical SMILES for (2S,4R)-azetidine-2,4-dicarboxamide is NC(=O)[C@@H]1C[C@H](C(N)=O)N1.
What is the InChIKey of (2S,4R)-azetidine-2,4-dicarboxamide?
The InChIKey is UNEMLOZFCVXAKB-WSOKHJQSSA-N. The full InChI is InChI=1S/C5H9N3O2/c6-4(9)2-1-3(8-2)5(7)10/h2-3,8H,1H2,(H2,6,9)(H2,7,10)/t2-,3+.
What are the key properties of (2S,4R)-azetidine-2,4-dicarboxamide?
(2S,4R)-azetidine-2,4-dicarboxamide has a molecular weight of 143.15 g/mol, XLogP of -2.31, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-azetidine-2,4-dicarboxamide is sourced from PubChem (CID 14654422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).