C44H38N4 — CID 146544402
2-[3,5-bis(2-tert-butylcarbazol-9-yl)-4-pyridinyl]benzonitrile (PubChem CID 146544402) has the molecular formula C44H38N4 and a molecular weight of 622.82 g/mol. Its IUPAC name is 2-[3,5-bis(2-tert-butylcarbazol-9-yl)-4-pyridinyl]benzonitrile.
| Compound Name | 2-[3,5-bis(2-tert-butylcarbazol-9-yl)-4-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 146544402 |
| Molecular Formula | C44H38N4 |
| Molecular Weight | 622.82 g/mol |
| Exact Mass | 622.31 |
| IUPAC Name | 2-[3,5-bis(2-tert-butylcarbazol-9-yl)-4-pyridinyl]benzonitrile |
| SMILES | CC(C)(C)c1ccc2c3ccccc3n(-c3cncc(-n4c5ccccc5c5ccc(C(C)(C)C)cc54)c3-c3ccccc3C#N)c2c1 |
| InChI | InChI=1S/C44H38N4/c1-43(2,3)29-19-21-34-32-15-9-11-17-36(32)47(38(34)23-29)40-26-46-27-41(42(40)31-14-8-7-13-28(31)25-45)48-37-18-12-10-16-33(37)35-22-20-30(24-39(35)48)44(4,5)6/h7-24,26-27H,1-6H3 |
| InChIKey | KZKVANFZRLBBSM-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 46.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.82 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |