C22H41NO5 — CID 14654504
tert-butyl (4S,5R)-4-(cyclohexylmethyl)-5-[(1S,3S)-1,4-dihydroxy-3-methylbutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 14654504) has the molecular formula C22H41NO5 and a molecular weight of 399.57 g/mol. Its IUPAC name is tert-butyl (4S,5R)-4-(cyclohexylmethyl)-5-[(1S,3S)-1,4-dihydroxy-3-methylbutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5R)-4-(cyclohexylmethyl)-5-[(1S,3S)-1,4-dihydroxy-3-methylbutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 14654504 |
| Molecular Formula | C22H41NO5 |
| Molecular Weight | 399.57 g/mol |
| Exact Mass | 399.30 |
| IUPAC Name | tert-butyl (4S,5R)-4-(cyclohexylmethyl)-5-[(1S,3S)-1,4-dihydroxy-3-methylbutyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C[C@H](CO)C[C@H](O)[C@@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@H]1CC1CCCCC1 |
| InChI | InChI=1S/C22H41NO5/c1-15(14-24)12-18(25)19-17(13-16-10-8-7-9-11-16)23(22(5,6)27-19)20(26)28-21(2,3)4/h15-19,24-25H,7-14H2,1-6H3/t15-,17-,18-,19+/m0/s1 |
| InChIKey | HFUOFPPDQYKXPL-DSLXNQLJSA-N |
| XLogP | 4.08 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |