About 3,5-dichloro-N-(2,4-difluoro-5-phenylphenyl)-2-hydroxybenzenesulfonamide
3,5-dichloro-N-(2,4-difluoro-5-phenylphenyl)-2-hydroxybenzenesulfonamide (PubChem CID 146545747) has the molecular formula C18H11Cl2F2NO3S
and a molecular weight of 430.26 g/mol. Its IUPAC name is 3,5-dichloro-N-(2,4-difluoro-5-phenylphenyl)-2-hydroxybenzenesulfonamide.
Molecular Properties
| Compound Name | 3,5-dichloro-N-(2,4-difluoro-5-phenylphenyl)-2-hydroxybenzenesulfonamide |
| PubChem CID | 146545747 |
| Molecular Formula | C18H11Cl2F2NO3S |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 428.98 |
| IUPAC Name | 3,5-dichloro-N-(2,4-difluoro-5-phenylphenyl)-2-hydroxybenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(-c2ccccc2)c(F)cc1F)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C18H11Cl2F2NO3S/c19-11-6-13(20)18(24)17(7-11)27(25,26)23-16-8-12(14(21)9-15(16)22)10-4-2-1-3-5-10/h1-9,23-24H |
| InChIKey | HADMESBEMPEXEI-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dichloro-N-(2,4-difluoro-5-phenylphenyl)-2-hydroxybenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-N-(2,4-difluoro-5-phenylphenyl)-2-hydroxybenzenesulfonamide?
The IUPAC name of 3,5-dichloro-N-(2,4-difluoro-5-phenylphenyl)-2-hydroxybenzenesulfonamide (CID 146545747) is 3,5-dichloro-N-(2,4-difluoro-5-phenylphenyl)-2-hydroxybenzenesulfonamide.
What is the SMILES notation for 3,5-dichloro-N-(2,4-difluoro-5-phenylphenyl)-2-hydroxybenzenesulfonamide?
The canonical SMILES for 3,5-dichloro-N-(2,4-difluoro-5-phenylphenyl)-2-hydroxybenzenesulfonamide is O=S(=O)(Nc1cc(-c2ccccc2)c(F)cc1F)c1cc(Cl)cc(Cl)c1O.
What is the InChIKey of 3,5-dichloro-N-(2,4-difluoro-5-phenylphenyl)-2-hydroxybenzenesulfonamide?
The InChIKey is HADMESBEMPEXEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11Cl2F2NO3S/c19-11-6-13(20)18(24)17(7-11)27(25,26)23-16-8-12(14(21)9-15(16)22)10-4-2-1-3-5-10/h1-9,23-24H.
What are the key properties of 3,5-dichloro-N-(2,4-difluoro-5-phenylphenyl)-2-hydroxybenzenesulfonamide?
3,5-dichloro-N-(2,4-difluoro-5-phenylphenyl)-2-hydroxybenzenesulfonamide has a molecular weight of 430.26 g/mol, XLogP of 5.45, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-N-(2,4-difluoro-5-phenylphenyl)-2-hydroxybenzenesulfonamide is sourced from PubChem (CID 146545747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).