About 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetic acid
2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetic acid (PubChem CID 146545827) has the molecular formula C20H13Cl2F2NO5S
and a molecular weight of 488.30 g/mol. Its IUPAC name is 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetic acid |
| PubChem CID | 146545827 |
| Molecular Formula | C20H13Cl2F2NO5S |
| Molecular Weight | 488.30 g/mol |
| Exact Mass | 486.99 |
| IUPAC Name | 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1c(Cl)cc(Cl)cc1S(=O)(=O)Nc1cc(-c2ccccc2)c(F)cc1F |
| InChI | InChI=1S/C20H13Cl2F2NO5S/c21-12-6-14(22)20(30-10-19(26)27)18(7-12)31(28,29)25-17-8-13(15(23)9-16(17)24)11-4-2-1-3-5-11/h1-9,25H,10H2,(H,26,27) |
| InChIKey | ORWDTPCEQUATLV-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.30 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetic acid?
The IUPAC name of 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetic acid (CID 146545827) is 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetic acid.
What is the SMILES notation for 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetic acid?
The canonical SMILES for 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetic acid is O=C(O)COc1c(Cl)cc(Cl)cc1S(=O)(=O)Nc1cc(-c2ccccc2)c(F)cc1F.
What is the InChIKey of 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetic acid?
The InChIKey is ORWDTPCEQUATLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13Cl2F2NO5S/c21-12-6-14(22)20(30-10-19(26)27)18(7-12)31(28,29)25-17-8-13(15(23)9-16(17)24)11-4-2-1-3-5-11/h1-9,25H,10H2,(H,26,27).
What are the key properties of 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetic acid?
2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetic acid has a molecular weight of 488.30 g/mol, XLogP of 5.20, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetic acid is sourced from PubChem (CID 146545827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).