About methyl 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetate
methyl 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetate (PubChem CID 146545947) has the molecular formula C21H15Cl2F2NO5S
and a molecular weight of 502.32 g/mol. Its IUPAC name is methyl 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetate.
Molecular Properties
| Compound Name | methyl 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetate |
| PubChem CID | 146545947 |
| Molecular Formula | C21H15Cl2F2NO5S |
| Molecular Weight | 502.32 g/mol |
| Exact Mass | 501.00 |
| IUPAC Name | methyl 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetate |
| SMILES | COC(=O)COc1c(Cl)cc(Cl)cc1S(=O)(=O)Nc1cc(-c2ccccc2)c(F)cc1F |
| InChI | InChI=1S/C21H15Cl2F2NO5S/c1-30-20(27)11-31-21-15(23)7-13(22)8-19(21)32(28,29)26-18-9-14(16(24)10-17(18)25)12-5-3-2-4-6-12/h2-10,26H,11H2,1H3 |
| InChIKey | ZBPYNMBGLYSOIS-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.32 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetate?
The IUPAC name of methyl 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetate (CID 146545947) is methyl 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetate.
What is the SMILES notation for methyl 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetate?
The canonical SMILES for methyl 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetate is COC(=O)COc1c(Cl)cc(Cl)cc1S(=O)(=O)Nc1cc(-c2ccccc2)c(F)cc1F.
What is the InChIKey of methyl 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetate?
The InChIKey is ZBPYNMBGLYSOIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15Cl2F2NO5S/c1-30-20(27)11-31-21-15(23)7-13(22)8-19(21)32(28,29)26-18-9-14(16(24)10-17(18)25)12-5-3-2-4-6-12/h2-10,26H,11H2,1H3.
What are the key properties of methyl 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetate?
methyl 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetate has a molecular weight of 502.32 g/mol, XLogP of 5.29, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2,4-dichloro-6-[(2,4-difluoro-5-phenylphenyl)sulfamoyl]phenoxy]acetate is sourced from PubChem (CID 146545947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).