About butyl 2-benzamidopropanoate
butyl 2-benzamidopropanoate (PubChem CID 14654753) has the molecular formula C14H19NO3
and a molecular weight of 249.31 g/mol. Its IUPAC name is butyl 2-benzamidopropanoate.
Molecular Properties
| Compound Name | butyl 2-benzamidopropanoate |
| PubChem CID | 14654753 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | butyl 2-benzamidopropanoate |
| SMILES | CCCCOC(=O)C(C)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H19NO3/c1-3-4-10-18-14(17)11(2)15-13(16)12-8-6-5-7-9-12/h5-9,11H,3-4,10H2,1-2H3,(H,15,16) |
| InChIKey | LBSNNWQUHWRQMX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-benzamidopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-benzamidopropanoate?
The IUPAC name of butyl 2-benzamidopropanoate (CID 14654753) is butyl 2-benzamidopropanoate.
What is the SMILES notation for butyl 2-benzamidopropanoate?
The canonical SMILES for butyl 2-benzamidopropanoate is CCCCOC(=O)C(C)NC(=O)c1ccccc1.
What is the InChIKey of butyl 2-benzamidopropanoate?
The InChIKey is LBSNNWQUHWRQMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3/c1-3-4-10-18-14(17)11(2)15-13(16)12-8-6-5-7-9-12/h5-9,11H,3-4,10H2,1-2H3,(H,15,16).
What are the key properties of butyl 2-benzamidopropanoate?
butyl 2-benzamidopropanoate has a molecular weight of 249.31 g/mol, XLogP of 2.15, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-benzamidopropanoate is sourced from PubChem (CID 14654753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).