About 4-N-(4-chlorophenyl)-1-methylpyrazolo[4,5-c]quinoline-3,4-diamine
4-N-(4-chlorophenyl)-1-methylpyrazolo[4,5-c]quinoline-3,4-diamine (PubChem CID 146547575) has the molecular formula C17H14ClN5
and a molecular weight of 323.79 g/mol. Its IUPAC name is 4-N-(4-chlorophenyl)-1-methylpyrazolo[4,5-c]quinoline-3,4-diamine.
Molecular Properties
| Compound Name | 4-N-(4-chlorophenyl)-1-methylpyrazolo[4,5-c]quinoline-3,4-diamine |
| PubChem CID | 146547575 |
| Molecular Formula | C17H14ClN5 |
| Molecular Weight | 323.79 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 4-N-(4-chlorophenyl)-1-methylpyrazolo[4,5-c]quinoline-3,4-diamine |
| SMILES | Cn1nc(N)c2c(Nc3ccc(Cl)cc3)nc3ccccc3c21 |
| InChI | InChI=1S/C17H14ClN5/c1-23-15-12-4-2-3-5-13(12)21-17(14(15)16(19)22-23)20-11-8-6-10(18)7-9-11/h2-9H,1H3,(H2,19,22)(H,20,21) |
| InChIKey | RRIBOCVSCZKOQF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.79 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-N-(4-chlorophenyl)-1-methylpyrazolo[4,5-c]quinoline-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(4-chlorophenyl)-1-methylpyrazolo[4,5-c]quinoline-3,4-diamine?
The IUPAC name of 4-N-(4-chlorophenyl)-1-methylpyrazolo[4,5-c]quinoline-3,4-diamine (CID 146547575) is 4-N-(4-chlorophenyl)-1-methylpyrazolo[4,5-c]quinoline-3,4-diamine.
What is the SMILES notation for 4-N-(4-chlorophenyl)-1-methylpyrazolo[4,5-c]quinoline-3,4-diamine?
The canonical SMILES for 4-N-(4-chlorophenyl)-1-methylpyrazolo[4,5-c]quinoline-3,4-diamine is Cn1nc(N)c2c(Nc3ccc(Cl)cc3)nc3ccccc3c21.
What is the InChIKey of 4-N-(4-chlorophenyl)-1-methylpyrazolo[4,5-c]quinoline-3,4-diamine?
The InChIKey is RRIBOCVSCZKOQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClN5/c1-23-15-12-4-2-3-5-13(12)21-17(14(15)16(19)22-23)20-11-8-6-10(18)7-9-11/h2-9H,1H3,(H2,19,22)(H,20,21).
What are the key properties of 4-N-(4-chlorophenyl)-1-methylpyrazolo[4,5-c]quinoline-3,4-diamine?
4-N-(4-chlorophenyl)-1-methylpyrazolo[4,5-c]quinoline-3,4-diamine has a molecular weight of 323.79 g/mol, XLogP of 4.10, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(4-chlorophenyl)-1-methylpyrazolo[4,5-c]quinoline-3,4-diamine is sourced from PubChem (CID 146547575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).