C11H9F3N2O3 — CID 146547602
3-methoxycarbonyl-1-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-1-ium-2-olate (PubChem CID 146547602) has the molecular formula C11H9F3N2O3 and a molecular weight of 274.20 g/mol. Its IUPAC name is 3-methoxycarbonyl-1-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-1-ium-2-olate.
| Compound Name | 3-methoxycarbonyl-1-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-1-ium-2-olate |
|---|---|
| PubChem CID | 146547602 |
| Molecular Formula | C11H9F3N2O3 |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 3-methoxycarbonyl-1-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-1-ium-2-olate |
| SMILES | COC(=O)c1c([O-])[n+](CC(F)(F)F)c2ccccn12 |
| InChI | InChI=1S/C11H9F3N2O3/c1-19-10(18)8-9(17)16(6-11(12,13)14)7-4-2-3-5-15(7)8/h2-5H,6H2,1H3 |
| InChIKey | PYVZSNVHVFEAAZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|