C9H8ClF3N2O — CID 146547618
1-(2,2,2-trifluoroethyl)-3H-imidazo[1,2-a]pyridin-4-ium-2-one chloride (PubChem CID 146547618) has the molecular formula C9H8ClF3N2O and a molecular weight of 252.62 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)-3H-imidazo[1,2-a]pyridin-4-ium-2-one chloride.
| Compound Name | 1-(2,2,2-trifluoroethyl)-3H-imidazo[1,2-a]pyridin-4-ium-2-one chloride |
|---|---|
| PubChem CID | 146547618 |
| Molecular Formula | C9H8ClF3N2O |
| Molecular Weight | 252.62 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)-3H-imidazo[1,2-a]pyridin-4-ium-2-one chloride |
| SMILES | O=C1C[n+]2ccccc2N1CC(F)(F)F.[Cl-] |
| InChI | InChI=1S/C9H8F3N2O.ClH/c10-9(11,12)6-14-7-3-1-2-4-13(7)5-8(14)15;/h1-4H,5-6H2;1H/q+1;/p-1 |
| InChIKey | WYDYAHPAEVMCMH-UHFFFAOYSA-M |
| XLogP | -2.11 |
| TPSA | 24.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.62 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|