C48H34N4 — CID 146549222
4-[3-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]phenyl]-6,10-diphenylphenanthridine (PubChem CID 146549222) has the molecular formula C48H34N4 and a molecular weight of 666.83 g/mol. Its IUPAC name is 4-[3-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]phenyl]-6,10-diphenylphenanthridine.
| Compound Name | 4-[3-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]phenyl]-6,10-diphenylphenanthridine |
|---|---|
| PubChem CID | 146549222 |
| Molecular Formula | C48H34N4 |
| Molecular Weight | 666.83 g/mol |
| Exact Mass | 666.28 |
| IUPAC Name | 4-[3-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]phenyl]-6,10-diphenylphenanthridine |
| SMILES | Cc1ccc(-c2nc(-c3ccc(C)cc3)nc(-c3cccc(-c4cccc5c4nc(-c4ccccc4)c4cccc(-c6ccccc6)c45)c3)n2)cc1 |
| InChI | InChI=1S/C48H34N4/c1-31-22-26-35(27-23-31)46-50-47(36-28-24-32(2)25-29-36)52-48(51-46)38-17-9-16-37(30-38)40-19-11-21-42-43-39(33-12-5-3-6-13-33)18-10-20-41(43)44(49-45(40)42)34-14-7-4-8-15-34/h3-30H,1-2H3 |
| InChIKey | MTZWBLUCHCGKAR-UHFFFAOYSA-N |
| XLogP | 12.19 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.83 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|