C56H35N5S — CID 146549555
4-[7'-(2,6-dipyridin-3-yl-4-pyridinyl)spiro[fluorene-9,9'-thioxanthene]-2'-yl]-2,6-diphenylpyrimidine (PubChem CID 146549555) has the molecular formula C56H35N5S and a molecular weight of 810.00 g/mol. Its IUPAC name is 4-[7'-(2,6-dipyridin-3-yl-4-pyridinyl)spiro[fluorene-9,9'-thioxanthene]-2'-yl]-2,6-diphenylpyrimidine.
| Compound Name | 4-[7'-(2,6-dipyridin-3-yl-4-pyridinyl)spiro[fluorene-9,9'-thioxanthene]-2'-yl]-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 146549555 |
| Molecular Formula | C56H35N5S |
| Molecular Weight | 810.00 g/mol |
| Exact Mass | 809.26 |
| IUPAC Name | 4-[7'-(2,6-dipyridin-3-yl-4-pyridinyl)spiro[fluorene-9,9'-thioxanthene]-2'-yl]-2,6-diphenylpyrimidine |
| SMILES | c1ccc(-c2cc(-c3ccc4c(c3)C3(c5cc(-c6cc(-c7cccnc7)nc(-c7cccnc7)c6)ccc5S4)c4ccccc4-c4ccccc43)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C56H35N5S/c1-3-13-36(14-4-1)51-33-52(61-55(60-51)37-15-5-2-6-16-37)39-24-26-54-48(30-39)56(45-21-9-7-19-43(45)44-20-8-10-22-46(44)56)47-29-38(23-25-53(47)62-54)42-31-49(40-17-11-27-57-34-40)59-50(32-42)41-18-12-28-58-35-41/h1-35H |
| InChIKey | ZEDYYNGVXWUUIW-UHFFFAOYSA-N |
| XLogP | 13.49 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.00 |
| LogP ≤ 5 | 13.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |