C58H36N4S — CID 146549899
3-[4-[4-(4-dibenzothiophen-4-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6,10-diphenylphenanthridine (PubChem CID 146549899) has the molecular formula C58H36N4S and a molecular weight of 821.02 g/mol. Its IUPAC name is 3-[4-[4-(4-dibenzothiophen-4-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6,10-diphenylphenanthridine.
| Compound Name | 3-[4-[4-(4-dibenzothiophen-4-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6,10-diphenylphenanthridine |
|---|---|
| PubChem CID | 146549899 |
| Molecular Formula | C58H36N4S |
| Molecular Weight | 821.02 g/mol |
| Exact Mass | 820.27 |
| IUPAC Name | 3-[4-[4-(4-dibenzothiophen-4-ylphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenyl]-6,10-diphenylphenanthridine |
| SMILES | c1ccc(-c2nc(-c3ccc(-c4ccc5c(c4)nc(-c4ccccc4)c4cccc(-c6ccccc6)c45)cc3)nc(-c3ccc(-c4cccc5c4sc4ccccc45)cc3)n2)cc1 |
| InChI | InChI=1S/C58H36N4S/c1-4-14-38(15-5-1)45-21-12-24-50-53(45)49-35-34-44(36-51(49)59-54(50)40-16-6-2-7-17-40)37-26-30-42(31-27-37)57-60-56(41-18-8-3-9-19-41)61-58(62-57)43-32-28-39(29-33-43)46-22-13-23-48-47-20-10-11-25-52(47)63-55(46)48/h1-36H |
| InChIKey | FTQPSKBRRISELM-UHFFFAOYSA-N |
| XLogP | 15.61 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.02 |
| LogP ≤ 5 | 15.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|