C8H10F8O2 — CID 146550154
3,3,4,4,5,5,6,6-octafluorooctane-2,7-diol (PubChem CID 146550154) has the molecular formula C8H10F8O2 and a molecular weight of 290.15 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6-octafluorooctane-2,7-diol.
| Compound Name | 3,3,4,4,5,5,6,6-octafluorooctane-2,7-diol |
|---|---|
| PubChem CID | 146550154 |
| Molecular Formula | C8H10F8O2 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 3,3,4,4,5,5,6,6-octafluorooctane-2,7-diol |
| SMILES | CC(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)O |
| InChI | InChI=1S/C8H10F8O2/c1-3(17)5(9,10)7(13,14)8(15,16)6(11,12)4(2)18/h3-4,17-18H,1-2H3 |
| InChIKey | GHXKXTAMIDFTCZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|