C11H11F — CID 146550362
2-ethynyl-1-fluoro-5,6-dimethylcyclohepta-1,3,5-triene (PubChem CID 146550362) has the molecular formula C11H11F and a molecular weight of 162.21 g/mol. Its IUPAC name is 2-ethynyl-1-fluoro-5,6-dimethylcyclohepta-1,3,5-triene.
| Compound Name | 2-ethynyl-1-fluoro-5,6-dimethylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 146550362 |
| Molecular Formula | C11H11F |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 2-ethynyl-1-fluoro-5,6-dimethylcyclohepta-1,3,5-triene |
| SMILES | C#CC1=C(F)CC(C)=C(C)C=C1 |
| InChI | InChI=1S/C11H11F/c1-4-10-6-5-8(2)9(3)7-11(10)12/h1,5-6H,7H2,2-3H3 |
| InChIKey | HWBISHZGRPFIAI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|