About 6-ethenyl-4,5-difluoro-3-methyl-1,2-dihydrobenzotriazole
6-ethenyl-4,5-difluoro-3-methyl-1,2-dihydrobenzotriazole (PubChem CID 146550378) has the molecular formula C9H9F2N3
and a molecular weight of 197.19 g/mol. Its IUPAC name is 6-ethenyl-4,5-difluoro-3-methyl-1,2-dihydrobenzotriazole.
Molecular Properties
| Compound Name | 6-ethenyl-4,5-difluoro-3-methyl-1,2-dihydrobenzotriazole |
| PubChem CID | 146550378 |
| Molecular Formula | C9H9F2N3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 6-ethenyl-4,5-difluoro-3-methyl-1,2-dihydrobenzotriazole |
| SMILES | C=Cc1cc2c(c(F)c1F)N(C)NN2 |
| InChI | InChI=1S/C9H9F2N3/c1-3-5-4-6-9(8(11)7(5)10)14(2)13-12-6/h3-4,12-13H,1H2,2H3 |
| InChIKey | ZQFRDWPMAVHKLF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethenyl-4,5-difluoro-3-methyl-1,2-dihydrobenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenyl-4,5-difluoro-3-methyl-1,2-dihydrobenzotriazole?
The IUPAC name of 6-ethenyl-4,5-difluoro-3-methyl-1,2-dihydrobenzotriazole (CID 146550378) is 6-ethenyl-4,5-difluoro-3-methyl-1,2-dihydrobenzotriazole.
What is the SMILES notation for 6-ethenyl-4,5-difluoro-3-methyl-1,2-dihydrobenzotriazole?
The canonical SMILES for 6-ethenyl-4,5-difluoro-3-methyl-1,2-dihydrobenzotriazole is C=Cc1cc2c(c(F)c1F)N(C)NN2.
What is the InChIKey of 6-ethenyl-4,5-difluoro-3-methyl-1,2-dihydrobenzotriazole?
The InChIKey is ZQFRDWPMAVHKLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2N3/c1-3-5-4-6-9(8(11)7(5)10)14(2)13-12-6/h3-4,12-13H,1H2,2H3.
What are the key properties of 6-ethenyl-4,5-difluoro-3-methyl-1,2-dihydrobenzotriazole?
6-ethenyl-4,5-difluoro-3-methyl-1,2-dihydrobenzotriazole has a molecular weight of 197.19 g/mol, XLogP of 1.89, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenyl-4,5-difluoro-3-methyl-1,2-dihydrobenzotriazole is sourced from PubChem (CID 146550378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).