C13H24F2N2 — CID 146550410
(2Z,4Z)-N-(2-ethylbutyl)-2,3-difluoro-N'-methylhexa-2,4-diene-1,6-diamine (PubChem CID 146550410) has the molecular formula C13H24F2N2 and a molecular weight of 246.34 g/mol. Its IUPAC name is (2Z,4Z)-N-(2-ethylbutyl)-2,3-difluoro-N'-methylhexa-2,4-diene-1,6-diamine.
| Compound Name | (2Z,4Z)-N-(2-ethylbutyl)-2,3-difluoro-N'-methylhexa-2,4-diene-1,6-diamine |
|---|---|
| PubChem CID | 146550410 |
| Molecular Formula | C13H24F2N2 |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | (2Z,4Z)-N-(2-ethylbutyl)-2,3-difluoro-N'-methylhexa-2,4-diene-1,6-diamine |
| SMILES | CCC(CC)CNC/C(F)=C(F)\C=C/CNC |
| InChI | InChI=1S/C13H24F2N2/c1-4-11(5-2)9-17-10-13(15)12(14)7-6-8-16-3/h6-7,11,16-17H,4-5,8-10H2,1-3H3/b7-6-,13-12- |
| InChIKey | MAIIFQMQUARHHD-ASZCUJMBSA-N |
| XLogP | 2.94 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|