C9H16FN — CID 146550491
(7R)-5-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole (PubChem CID 146550491) has the molecular formula C9H16FN and a molecular weight of 157.23 g/mol. Its IUPAC name is (7R)-5-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole.
| Compound Name | (7R)-5-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole |
|---|---|
| PubChem CID | 146550491 |
| Molecular Formula | C9H16FN |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | (7R)-5-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole |
| SMILES | C[C@@H]1CC(F)CC2CCNC21 |
| InChI | InChI=1S/C9H16FN/c1-6-4-8(10)5-7-2-3-11-9(6)7/h6-9,11H,2-5H2,1H3/t6-,7?,8?,9?/m1/s1 |
| InChIKey | PVSDJCWNYLHYPE-LJSVPSOQSA-N |
| XLogP | 1.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |